4920-81-4 Usage
Description
3-HYDROXYANTHRANILIC ACID HYDROCHLORIDE, with the CAS number 4920-81-4, is an organic compound that serves as a crucial intermediate in the synthesis of various pharmaceuticals and chemical compounds. It is characterized by its unique chemical structure and reactivity, which allows it to participate in esterification and cyclization reactions.
Uses
Used in Pharmaceutical Industry:
3-HYDROXYANTHRANILIC ACID HYDROCHLORIDE is used as a reagent for esterification and cyclization with geldanamycin. This application is significant because it plays a vital role in the synthesis of complex pharmaceutical compounds, which can have various therapeutic applications, including the development of new drugs to treat different diseases and medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 4920-81-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,9,2 and 0 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 4920-81:
(6*4)+(5*9)+(4*2)+(3*0)+(2*8)+(1*1)=94
94 % 10 = 4
So 4920-81-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO3.ClH/c8-6-4(7(10)11)2-1-3-5(6)9;/h1-3,9H,8H2,(H,10,11);1H
