4955-32-2 Usage
General Description
1,3,6,10-Farnesatetraen-12-al is a volatile organic compound found in various plant species. This chemical substance is a vital component of essential oils and contributes significantly to their fragrance. As an odorous compound, 1,3,6,10-Farnesatetraen-12-al plays a crucial role in the food, cosmetic, and perfume industries. It has sedative effects and interacts with neurotransmitters, which can enhance sleep quality. Furthermore, this compound possesses antimicrobial, antioxidative, and anticarcinogenic properties, showcasing its potential in nutraceutical, pharmaceutical, and healthcare applications.
Check Digit Verification of cas no
The CAS Registry Mumber 4955-32-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,9,5 and 5 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4955-32:
(6*4)+(5*9)+(4*5)+(3*5)+(2*3)+(1*2)=112
112 % 10 = 2
So 4955-32-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H22O/c1-5-13(2)8-6-9-14(3)10-7-11-15(4)12-16/h5,8-9,11-12H,1,6-7,10H2,2-4H3