49739-24-4 Usage
General Description
1-Isopropyl-2,5-dimethylimidazole is a chemical compound that belongs to the imidazole group, which is a five-membered ring containing two nitrogen atoms. 1-ISOPROPYL-2,5-DIMETHYLIMIDAZOLE is used in various industrial applications, including as a corrosion inhibitor in oil and gas production, as a catalyst in organic synthesis, and as an additive in coatings and adhesives. It is also used in the production of pharmaceuticals, agrochemicals, and electronics. 1-Isopropyl-2,5-dimethylimidazole is known for its ability to improve the stability and performance of various materials, making it a valuable ingredient in many different products. Additionally, it has a relatively low toxicity and is considered to be safe for use in the specified applications.
Check Digit Verification of cas no
The CAS Registry Mumber 49739-24-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,9,7,3 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 49739-24:
(7*4)+(6*9)+(5*7)+(4*3)+(3*9)+(2*2)+(1*4)=164
164 % 10 = 4
So 49739-24-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N2/c1-6(2)10-7(3)5-9-8(10)4/h5-6H,1-4H3