5018-45-1 Usage
Description
5,6-Dimethoxypyrimidin-4-ylamine is an organic compound with the molecular formula C6H8N2O2. It is a derivative of pyrimidine, a heterocyclic aromatic organic compound consisting of a six-membered ring containing four carbon atoms and two nitrogen atoms. The molecule is characterized by the presence of two methoxy groups (-OCH3) at the 5th and 6th positions and an amine group (-NH2) at the 4th position.
Uses
Used in Pharmaceutical Industry:
5,6-Dimethoxypyrimidin-4-ylamine is used as an impurity in the synthesis of Sulfadoxine (S699070), an antibacterial agent. Sulfadoxine is a sulfonamide antibiotic that is commonly used in combination with other drugs, such as pyrimethamine, to treat various bacterial infections, including urinary tract infections, bronchitis, and traveler's diarrhea.
As an intermediate in the synthesis of other pharmaceutical compounds, 5,6-Dimethoxypyrimidin-4-ylamine can be further modified or reacted with other molecules to produce a variety of therapeutic agents with different applications in the medical field. Its unique chemical structure allows for potential use in the development of new drugs targeting various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 5018-45-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,0,1 and 8 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5018-45:
(6*5)+(5*0)+(4*1)+(3*8)+(2*4)+(1*5)=71
71 % 10 = 1
So 5018-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3O2/c1-10-4-5(7)8-3-9-6(4)11-2/h3H,1-2H3,(H2,7,8,9)