501944-63-4 Usage
General Description
5-(4-Ethynylphenyl)-1,3-oxazole is a chemical compound that belongs to the class of oxazoles, which are five-membered heterocyclic compounds containing one oxygen and one nitrogen atom in the ring. This specific compound is characterized by the presence of an ethynyl group and a phenyl group attached to the oxazole ring. It is commonly used as a building block in organic synthesis and medicinal chemistry, and has potential applications in pharmaceuticals and agrochemicals. Its structure and properties make it a versatile precursor for the synthesis of various bioactive compounds and materials. Additionally, research has shown that 5-(4-Ethynylphenyl)-1,3-oxazole may exhibit biological activity, particularly as an antimicrobial and antifungal agent, making it a potentially valuable chemical for drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 501944-63-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,1,9,4 and 4 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 501944-63:
(8*5)+(7*0)+(6*1)+(5*9)+(4*4)+(3*4)+(2*6)+(1*3)=134
134 % 10 = 4
So 501944-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H7NO/c1-2-9-3-5-10(6-4-9)11-7-12-8-13-11/h1,3-8H
