502685-70-3 Usage
General Description
5-(2-Methoxybenzyl)-4H-1,2,4-triazol-3-amine is a chemical compound with the molecular formula C10H12N4O. It is a triazole derivative with a 2-methoxybenzyl group attached to the triazole ring. 5-(2-Methoxybenzyl)-4H-1,2,4-triazol-3-amine has potential biological activities and is often used as a building block in the synthesis of pharmaceuticals and agrochemicals. It may also possess antifungal and anticancer properties, making it a valuable compound for medicinal chemistry research. Additionally, its unique structure and properties make it an interesting target for further study in the field of organic chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 502685-70-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,2,6,8 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 502685-70:
(8*5)+(7*0)+(6*2)+(5*6)+(4*8)+(3*5)+(2*7)+(1*0)=143
143 % 10 = 3
So 502685-70-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N4O/c1-15-8-5-3-2-4-7(8)6-9-12-10(11)14-13-9/h2-5H,6H2,1H3,(H3,11,12,13,14)