502685-73-6 Usage
General Description
5-(3-Methoxybenzyl)-4H-1,2,4-triazol-3-amine is a chemical compound with the molecular formula C10H12N4O. It is a triazolamine derivative with a 1,2,4-triazole ring and a methoxybenzyl group attached to the nitrogen atom. 5-(3-Methoxybenzyl)-4H-1,2,4-triazol-3-amine has potential biological activities and is often used in medicinal chemistry and pharmaceutical research. It may have applications in drug development, particularly in the synthesis of new pharmaceuticals with potential therapeutic uses. Additionally, its structural features make it a potential candidate for further investigation in the fields of pharmacology and medicinal chemistry. Further research is warranted to explore its potential uses and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 502685-73-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,2,6,8 and 5 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 502685-73:
(8*5)+(7*0)+(6*2)+(5*6)+(4*8)+(3*5)+(2*7)+(1*3)=146
146 % 10 = 6
So 502685-73-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N4O/c1-15-8-4-2-3-7(5-8)6-9-12-10(11)14-13-9/h2-5H,6H2,1H3,(H3,11,12,13,14)
