50375-08-1 Usage
Structure
Benzene derivative with two ethoxy (C2H5O) groups and a chlorine atom attached to the benzene ring
Physical state
Clear, colorless liquid
Molecular weight
206.66 g/mol
Applications
Intermediate in the synthesis of pharmaceuticals and agrochemicals
Use as a reagent
Introduces the 3,5-diethoxyphenyl group into various chemical compounds
Toxicity
Toxic if ingested, inhaled, or absorbed through the skin
Hazards
Can cause irritation to the respiratory system and skin
Safety precautions
Handle with care and follow proper safety protocols to minimize exposure and potential health risks
Check Digit Verification of cas no
The CAS Registry Mumber 50375-08-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,3,7 and 5 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 50375-08:
(7*5)+(6*0)+(5*3)+(4*7)+(3*5)+(2*0)+(1*8)=101
101 % 10 = 1
So 50375-08-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H13ClO2/c1-3-12-9-5-8(11)6-10(7-9)13-4-2/h5-7H,3-4H2,1-2H3
