504-44-9 Usage
General Description
2,6,11,15-Tetramethylhexadecane is a chemical compound with the molecular formula C22H46. It belongs to the class of organic compounds known as hydrocarbons, which are compounds made up of only hydrogen and carbon atoms. This particular compound is a highly branched alkane, with four methyl groups attached to the sixteenth carbon atom of a sixteen-carbon chain. It is a colorless, odorless liquid with a high boiling point, making it suitable for use as a solvent in various industrial and commercial applications. It is also used in the production of lubricants, plasticizers, and other chemical products. Additionally, it is known for its stability and resistance to chemical reactions, making it a valuable ingredient in many formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 504-44-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,0 and 4 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 504-44:
(5*5)+(4*0)+(3*4)+(2*4)+(1*4)=49
49 % 10 = 9
So 504-44-9 is a valid CAS Registry Number.
InChI:InChI=1/C20H42/c1-17(2)11-9-15-19(5)13-7-8-14-20(6)16-10-12-18(3)4/h17-20H,7-16H2,1-6H3