50798-38-4 Usage
General Description
2-({3-nitro-2-pyridinyl}amino)ethanol is a synthetic organic compound with a molecular formula of C7H9N3O3. It's a derivative of ethanol, with the addition of a pyridine ring, which incorporates a nitrogen atom and nitro-group commonly used in organic chemistry. This specific compound falls into the category of amines, which are defined by the presence of a nitrogen atom with a lone pair. Amines such as this compound are foundational in the development of medications and pharmaceuticals. Concerning its physical properties, information like its boiling point, melting point, or toxicological properties, generally depend on its specific handling and storage conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 50798-38-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,7,9 and 8 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 50798-38:
(7*5)+(6*0)+(5*7)+(4*9)+(3*8)+(2*3)+(1*8)=144
144 % 10 = 4
So 50798-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O3/c11-5-4-9-7-6(10(12)13)2-1-3-8-7/h1-3,11H,4-5H2,(H,8,9)