5094-42-8 Usage
General Description
2,3-DIMETHYL-1 H-INDOLE-5-CARBOXYLIC ACID HYDRAZIDE is a chemical compound with the molecular formula C11H14N4O2. It is commonly used as a building block in the synthesis of pharmaceuticals and agrochemicals. 2,3-DIMETHYL-1 H-INDOLE-5-CARBOXYLIC ACID HYDRAZIDE is also known for its potential application in the field of organic chemistry as a reagent for the preparation of various biologically active molecules. Additionally, it is used as a raw material for the production of dyes and other specialty chemicals. This chemical is typically handled and stored in accordance with standard laboratory procedures and safety measures due to its potential health and environmental hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 5094-42-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,0,9 and 4 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5094-42:
(6*5)+(5*0)+(4*9)+(3*4)+(2*4)+(1*2)=88
88 % 10 = 8
So 5094-42-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H13N3O/c1-6-7(2)13-10-4-3-8(5-9(6)10)11(15)14-12/h3-5,13H,12H2,1-2H3,(H,14,15)