516474-08-1 Usage
Ionic liquid
Consists entirely of ions 1-ETHYL-2,3-DIMETHYLIMIDAZOLIUM ETHYL SU is an ionic liquid, meaning it is composed of cations and anions, which gives it unique properties compared to traditional molecular compounds.
Low melting point
Very low melting point As an ionic liquid, 1-ETHYL-2,3-DIMETHYLIMIDAZOLIUM ETHYL SU has a very low melting point, allowing it to remain in a liquid state at relatively low temperatures.
Solvent
Used in chemical reactions and processes Due to its unique properties, 1-ETHYL-2,3-DIMETHYLIMIDAZOLIUM ETHYL SU is often used as a solvent in various chemical reactions and processes, providing a stable and efficient medium for these reactions to occur.
Electrochemical applications
Utilized in electrochemistry The compound's ionic nature makes it suitable for use in electrochemical applications, such as batteries and supercapacitors.
Low toxicity
Known for its low toxicity 1-ETHYL-2,3-DIMETHYLIMIDAZOLIUM ETHYL SU is less harmful to human health and the environment compared to other chemicals, making it a safer option for various applications.
Environmentally friendly
Popular choice in green chemistry practices The low toxicity and environmental impact of 1-ETHYL-2,3-DIMETHYLIMIDAZOLIUM ETHYL SU make it a preferred choice in green chemistry, which focuses on sustainable and eco-friendly chemical processes.
Pharmaceutical potential
Studied for pharmaceutical use Researchers have investigated the potential use of 1-ETHYL-2,3-DIMETHYLIMIDAZOLIUM ETHYL SU in pharmaceuticals, as it has shown promise in drug delivery applications, potentially improving the effectiveness and safety of medications.
Wide range of potential uses
Valuable for its unique properties The combination of low toxicity, environmental friendliness, and versatility in various applications make 1-ETHYL-2,3-DIMETHYLIMIDAZOLIUM ETHYL SU a valuable compound with a broad range of potential uses in science and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 516474-08-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,1,6,4,7 and 4 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 516474-08:
(8*5)+(7*1)+(6*6)+(5*4)+(4*7)+(3*4)+(2*0)+(1*8)=151
151 % 10 = 1
So 516474-08-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H13N2.C2H6O4S/c1-4-9-6-5-8(3)7(9)2;1-2-6-7(3,4)5/h5-6H,4H2,1-3H3;2H2,1H3,(H,3,4,5)/q+1;/p-1
