518-60-5 Usage
General Description
The chemical "[8S,(-)]-7,10-Dihydro-10-methyl-8-(1-methylethyl)-1,3-dioxolo[4,5-h]furo[2,3-b]quinoline-6(8H)-one" is a complex organic compound with a fused-ring structure. It contains a mixture of carbon, hydrogen, and oxygen atoms, arranged in a specific configuration. The compound has a quinoline ring system, with additional oxygen-containing functional groups. Its name suggests that it is a stereoisomer with a specific stereochemistry. Not much information is readily available about the exact properties or uses of this chemical, likely due to its complex and specialized nature. However, it could potentially have pharmaceutical or biological applications due to its intricate structure.
Check Digit Verification of cas no
The CAS Registry Mumber 518-60-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,1 and 8 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 518-60:
(5*5)+(4*1)+(3*8)+(2*6)+(1*0)=65
65 % 10 = 5
So 518-60-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H17NO4/c1-8(2)12-6-10-14(18)9-4-5-11-15(20-7-19-11)13(9)17(3)16(10)21-12/h4-5,8,12H,6-7H2,1-3H3