51802-61-0 Usage
General Description
5-METHYL-7-PHENYL-6,7-DIHYDRO-1H-1,4-DIAZEPINE-2,3-DICARBONITRILE is a chemical compound that belongs to the class of diazepines. It is a heterocyclic compound containing a seven-membered diazepine ring with two cyano groups attached at positions 2 and 3. The presence of a methyl group at position 5 and a phenyl group at position 7 adds to the complexity and functionality of the molecule. 5-METHYL-7-PHENYL-6,7-DIHYDRO-1H-1,4-DIAZEPINE-2,3-DICARBONITRILE has potential applications in medicinal chemistry and pharmaceutical research due to its unique molecular structure and potential biological activities. It may be used as a building block for the synthesis of new drugs or as a starting material for the development of novel chemical entities with therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 51802-61-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,8,0 and 2 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 51802-61:
(7*5)+(6*1)+(5*8)+(4*0)+(3*2)+(2*6)+(1*1)=100
100 % 10 = 0
So 51802-61-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N4/c1-10-7-12(11-5-3-2-4-6-11)18-14(9-16)13(8-15)17-10/h2-6,12-13H,7H2,1H3/t12-,13+/m0/s1