51867-94-8 Usage
Description
9-Methylstreptimidone is a straight chain member of the glutarimide family, which is a class of organic compounds. It was first reported in 1974 and has been isolated from various species of Streptomyces, a genus of Gram-positive bacteria known for producing a wide range of bioactive compounds. 9-methylstreptimidone possesses antifungal and prophylactic antiviral properties, making it a valuable pharmaceutical candidate for various applications.
Uses
Used in Antifungal Applications:
9-Methylstreptimidone is used as an antifungal agent for treating various fungal infections. Its effectiveness in combating fungi makes it a potential candidate for the development of new antifungal drugs and therapies.
Used in Antiviral Applications:
9-Methylstreptimidone is used as a prophylactic antiviral agent, which means it helps prevent the onset of viral infections. Its antiviral activity is attributed to its ability to induce the production of interferon, a protein that plays a crucial role in the immune response against viral infections.
Used in Inhibition of NF-κB:
9-Methylstreptimidone is also used as an inhibitor of the nuclear factor, NF-κB. NF-κB is a protein complex that controls the transcription of DNA, cytokine production, and cell survival. By inhibiting NF-κB, 9-methylstreptimidone can potentially be used in the development of therapies for various diseases, including cancer and inflammatory disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 51867-94-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,8,6 and 7 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 51867-94:
(7*5)+(6*1)+(5*8)+(4*6)+(3*7)+(2*9)+(1*4)=148
148 % 10 = 8
So 51867-94-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H25NO4/c1-4-5-11(2)6-12(3)15(20)10-14(19)7-13-8-16(21)18-17(22)9-13/h4-6,12-14,19H,7-10H2,1-3H3,(H,18,21,22)
