5192-62-1 Usage
Description
4-Hydroxy-3,6-dimethyl-2H-pyran-2-one is an organic compound characterized by its unique chemical structure, which features a pyranone ring with specific functional groups. This molecule is known for its potential applications in various fields due to its chemical properties.
Uses
Used in Pharmaceutical Industry:
4-Hydroxy-3,6-dimethyl-2H-pyran-2-one is used as a reactant for the synthesis of unnatural novel polyketides. These polyketides have shown promise in the development of new drugs with potential therapeutic applications, making this compound an important building block in the pharmaceutical industry.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-hydroxy-3,6-dimethyl-2H-pyran-2-one serves as a key intermediate in the production of various complex organic molecules. Its unique structure allows for further functionalization and modification, leading to the creation of new compounds with diverse applications.
Used in Research and Development:
4-Hydroxy-3,6-dimethyl-2H-pyran-2-one is also utilized in research and development settings, where it can be employed to study the properties and reactivity of similar compounds. This can lead to a better understanding of their potential uses and the development of new methodologies for their synthesis and application.
Synthesis Reference(s)
Synthesis, p. 259, 1975 DOI: 10.1055/s-1975-23723
Check Digit Verification of cas no
The CAS Registry Mumber 5192-62-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,9 and 2 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5192-62:
(6*5)+(5*1)+(4*9)+(3*2)+(2*6)+(1*2)=91
91 % 10 = 1
So 5192-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O3/c1-4-3-6(8)5(2)7(9)10-4/h3,8H,1-2H3
5192-62-1Relevant articles and documents
Enol Ethers, XIV. Acylation of Keto Enol Ethers with Malonyl Dichloride - A New Synthesis of Phloroglucinols
Effenberger, Franz,Schoenwaelder, Karl-Heinz
, p. 3270 - 3279 (2007/10/02)
Phloroglucinols 4 and/or 4-hydroxy-2H-pyran-2-ones 5 are formed from keto enol ethers 1 and malonyl dichloride (2a) in high yields.Since the pyranones 5 can be smoothly converted into phloroglucinols, the reaction of 1 with 2a represents a new, facile synthetic route to phloroglucinols.The reaction proceeds via formation of a chloro carbonyl ketene 8 and its subsequent reaction with 1.The product ratio 4:5 is rationalized in terms of substituent effects in the enol ether substrate.
