520-17-2 Usage
General Description
Leucopelargonidin, also known as (2R,3S,4S)-flavylium, is a type of flavan-4-ol, a member of the flavonoid chemical subclass. It's a unique chemical compound derived primarily from plants, imparting various health benefits as seen in related flavonoids. These chemicals are known for their antioxidant properties and for reducing inflammation. However, specific information regarding the health effects, toxicity, and overall usage of leucopelargonidin is limited, largely because this compound is a significant intermediate in the biosynthesis of anthocyanins, but isn't typically found as a free molecule in nature. This means that its bioavailability and effects when consumed are not well-studied or understood. Nonetheless, it's an essential compound in plant chemistry, proving vital for color in many species of plants.
Check Digit Verification of cas no
The CAS Registry Mumber 520-17-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,2 and 0 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 520-17:
(5*5)+(4*2)+(3*0)+(2*1)+(1*7)=42
42 % 10 = 2
So 520-17-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H14O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,13-20H
