52088-11-6 Usage
Description
3,5-Dibromo-1-methyl-1H-indazole is a chemical compound with the molecular formula C9H7Br2N. It belongs to the class of indazoles, which are aromatic heterocyclic compounds. 3,5-Dibromo-1-methyl-1H-indazole is a derivative of indazole, featuring two bromine atoms and a methyl group attached to the 3rd and 5th positions of the indazole ring, respectively. Its unique structure and properties make it a promising candidate for various applications, particularly in the pharmaceutical and agrochemical industries.
Uses
Used in Pharmaceutical Research and Development:
3,5-Dibromo-1-methyl-1H-indazole is used as a building block for the synthesis of various bioactive molecules. Its unique structure allows it to be a valuable component in the development of new drugs, potentially contributing to the creation of innovative therapeutic agents.
Used in Agrochemicals:
3,5-Dibromo-1-methyl-1H-indazole has potential applications in the field of agrochemicals. It may be utilized as an intermediate in the production of specialty chemicals designed for agricultural purposes, such as pesticides or herbicides, due to its chemical properties and potential biological activity.
Used in the Development of New Drugs:
Due to its structure and properties, 3,5-Dibromo-1-methyl-1H-indazole has potential biological activity, which may lead to its use in the development of new drugs. Its unique chemical composition could contribute to the discovery of novel therapeutic agents with specific target actions and improved efficacy.
Used in the Production of Specialty Chemicals:
3,5-Dibromo-1-methyl-1H-indazole may also be used as an intermediate in the production of specialty chemicals. Its unique characteristics make it a valuable component in the synthesis of various chemical products, further expanding its range of applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 52088-11-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,0,8 and 8 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 52088-11:
(7*5)+(6*2)+(5*0)+(4*8)+(3*8)+(2*1)+(1*1)=106
106 % 10 = 6
So 52088-11-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H6Br2N2/c1-12-7-3-2-5(9)4-6(7)8(10)11-12/h2-4H,1H3
