5219-17-0 Usage
Description
4-ETHYL-7-HYDROXY-3-(P-METHOXYPHENYL)-DIHYDRO-1-BENZOPYRAN-2-ONE, also known as a hydroxycoumarin, is a chemical compound belonging to the class of benzopyrans. It is characterized by the presence of an ethyl group at position 4, a hydroxy group at position 7, and a p-methoxyphenyl group at position 3. This molecule exhibits unique structural features that make it a versatile compound with potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
4-ETHYL-7-HYDROXY-3-(P-METHOXYPHENYL)-DIHYDRO-1-BENZOPYRAN-2-ONE is used as a pharmaceutical compound for its potential therapeutic properties. The presence of the hydroxy and p-methoxyphenyl groups allows for interactions with various biological targets, making it a promising candidate for the development of new drugs.
Used in Chemical Synthesis:
In the chemical industry, 4-ETHYL-7-HYDROXY-3-(P-METHOXYPHENYL)-DIHYDRO-1-BENZOPYRAN-2-ONE can be used as a key intermediate in the synthesis of more complex molecules, such as other hydroxycoumarins or benzopyran derivatives. Its unique structural features enable it to serve as a building block for the development of novel compounds with diverse applications.
Used in Research and Development:
4-ETHYL-7-HYDROXY-3-(P-METHOXYPHENYL)-DIHYDRO-1-BENZOPYRAN-2-ONE is also utilized in research and development settings, where it can be employed as a model compound to study the properties and reactivity of hydroxycoumarins and benzopyrans. This can lead to a better understanding of the structure-activity relationships and the development of new synthetic strategies for these types of compounds.
Used in Material Science:
The unique structural features of 4-ETHYL-7-HYDROXY-3-(P-METHOXYPHENYL)-DIHYDRO-1-BENZOPYRAN-2-ONE may also find applications in the field of material science, where it could be used to develop new materials with specific properties, such as improved stability, solubility, or reactivity.
Synthesis Reference(s)
The Journal of Organic Chemistry, 30, p. 4114, 1965 DOI: 10.1021/jo01023a032
Hazard
A reproductive hazard.
Check Digit Verification of cas no
The CAS Registry Mumber 5219-17-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,2,1 and 9 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5219-17:
(6*5)+(5*2)+(4*1)+(3*9)+(2*1)+(1*7)=80
80 % 10 = 0
So 5219-17-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H16O4/c1-3-14-15-9-6-12(19)10-16(15)22-18(20)17(14)11-4-7-13(21-2)8-5-11/h4-10,19H,3H2,1-2H3