522-20-3 Usage
Explanation
The molecular formula represents the number of atoms of each element present in the compound.
Explanation
The compound is composed of an acridine ring, which is fused with a diethylamino-propan-2-ol group.
Explanation
It is an organic compound as it contains carbon and hydrogen atoms.
Explanation
The compound contains a chloro group at the 6-position, a methoxy group at the 2-position of the acridine ring, and a diethylamino group attached to the propan-2-ol.
Explanation
The compound is known for its potential pharmaceutical properties, making it a candidate for further research.
Explanation
The compound is being studied for its potential use as an anti-cancer agent due to its unique chemical structure and functional groups.
Explanation
The presence of these functional groups contributes to the compound's medicinal properties, making it a promising candidate for pharmaceutical applications.
Explanation
The compound has a potential for further research and development in the fields of pharmacology and medicine, particularly in the area of cancer treatment.
Explanation
The solubility of the compound in various solvents is not provided in the material.
Explanation
The stability of the compound under different conditions is not provided in the material.
Chemical structure
Acridine moiety linked to a diethylamino-propan-2-ol group
Organic compound
Yes
Presence of functional groups
Chloro, methoxy, and diethylamino groups
Potential pharmaceutical properties
Yes
Potential use
Anti-cancer agent
Medicinal properties
Influenced by chloro and methoxy groups, and diethylamino-propan-2-ol group
Research and development
Pharmacology and medicine
Solubility
Not mentioned in the material
Stability
Not mentioned in the material
Check Digit Verification of cas no
The CAS Registry Mumber 522-20-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,2 and 2 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 522-20:
(5*5)+(4*2)+(3*2)+(2*2)+(1*0)=43
43 % 10 = 3
So 522-20-3 is a valid CAS Registry Number.
InChI:InChI=1/C21H26ClN3O2/c1-4-25(5-2)13-15(26)12-23-21-17-8-6-14(22)10-20(17)24-19-9-7-16(27-3)11-18(19)21/h6-11,15,26H,4-5,12-13H2,1-3H3,(H,23,24)