52200-08-5 Usage
Description
(E)-2-(3-CHLOROBENZOYL)-3-(DIMETHYLAMINO)ACRYLONITRILE is a chemical compound with the molecular formula C14H12ClN3O. It is a nitrile derivative and a monocarboxylic acid anhydride, which means it contains a cyano group and an acryloyl group. (E)-2-(3-CHLOROBENZOYL)-3-(DIMETHYLAMINO)ACRYLONITRILE is characterized by the presence of a chlorobenzoyl group and a dimethylamino group, making it a versatile starting material for the synthesis of a wide range of functionalized molecules with diverse applications in organic chemistry.
Uses
Used in Pharmaceutical Industry:
(E)-2-(3-CHLOROBENZOYL)-3-(DIMETHYLAMINO)ACRYLONITRILE is used as an intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
(E)-2-(3-CHLOROBENZOYL)-3-(DIMETHYLAMINO)ACRYLONITRILE is also used as an intermediate in the synthesis of agrochemicals, contributing to the development of new pesticides or other agricultural products to improve crop yield and protect plants from pests.
Used in Organic Compounds Synthesis:
(E)-2-(3-CHLOROBENZOYL)-3-(DIMETHYLAMINO)ACRYLONITRILE serves as a key intermediate in the synthesis of various organic compounds, enabling the creation of molecules with specific properties for different applications in organic chemistry.
Used in Materials Science:
It has potential applications in materials science, as it can act as a building block for designing new functional materials. (E)-2-(3-CHLOROBENZOYL)-3-(DIMETHYLAMINO)ACRYLONITRILE's structural features make it a promising candidate for the development of advanced materials with unique properties.
Check Digit Verification of cas no
The CAS Registry Mumber 52200-08-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,2,0 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 52200-08:
(7*5)+(6*2)+(5*2)+(4*0)+(3*0)+(2*0)+(1*8)=65
65 % 10 = 5
So 52200-08-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H11ClN2O/c1-15(2)8-10(7-14)12(16)9-4-3-5-11(13)6-9/h3-6,8H,1-2H3/b10-8+
52200-08-5Relevant articles and documents
AMINOPYRAZOLE DERIVATIVE
-
Page/Page column 132, (2012/07/14)
A compound represented by formula (I) or a pharmacologically acceptable salt thereof, which can inhibit a fibroblast growth factor receptor (FGFR) family kinase in cancer tissues. (In the formula, A represents a 5- to 10-membered heteroaryl group, or a C