52740-90-6 Usage
General Description
1-amino-N-(3-bromo-9,10-dihydro-9,10-dioxo-2-anthryl)-9,10-dihydro-9,10-dioxoanthracene-2-carboxamide is a chemical compound consisting of an anthracene core with additional functional groups. It contains a carboxamide group, a bromine atom, and a 1-amino group. 1-amino-N-(3-bromo-9,10-dihydro-9,10-dioxo-2-anthryl)-9,10-dihydro-9,10-dioxoanthracene-2-carboxamide is a derivative of anthracene and has potential applications in the field of organic chemistry and material science. Its precise properties and potential uses would be determined through further research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 52740-90-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,7,4 and 0 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 52740-90:
(7*5)+(6*2)+(5*7)+(4*4)+(3*0)+(2*9)+(1*0)=116
116 % 10 = 6
So 52740-90-6 is a valid CAS Registry Number.
InChI:InChI=1/C29H15BrN2O5/c30-21-11-19-20(27(35)14-6-2-1-5-13(14)26(19)34)12-22(21)32-29(37)18-10-9-17-23(24(18)31)28(36)16-8-4-3-7-15(16)25(17)33/h1-12H,31H2,(H,32,37)