5287-46-7 Usage
Description
Prenisteine, also known as a prenylcysteine derivative, is a compound characterized by a prenyl group attached to the side-chain sulfur atom of L-cysteine. This unique structure endows Prenisteine with specific properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
Prenisteine is used as a therapeutic agent for the treatment of various diseases, particularly those related to inflammation and immune system modulation. Its unique structure allows it to interact with specific biological targets, making it a promising candidate for drug development.
Used in Chemical Research:
Prenisteine serves as a valuable compound in chemical research, particularly in the study of prenylated natural products and their biological activities. Its unique structure provides insights into the synthesis, modification, and potential applications of prenylated compounds.
Used in Drug Delivery Systems:
Similar to gallotannin, Prenisteine can also be incorporated into drug delivery systems to enhance its bioavailability, delivery, and therapeutic outcomes. By employing various carriers such as organic and metallic nanoparticles, the limitations of Prenisteine can be overcome, leading to improved efficacy in targeted applications.
Check Digit Verification of cas no
The CAS Registry Mumber 5287-46-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,2,8 and 7 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5287-46:
(6*5)+(5*2)+(4*8)+(3*7)+(2*4)+(1*6)=107
107 % 10 = 7
So 5287-46-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2S/c1-6(2)3-4-12-5-7(9)8(10)11/h3,7H,4-5,9H2,1-2H3,(H,10,11)/t7-/m0/s1
