52870-46-9 Usage
General Description
Benzenamine, N-4-(1,3-dimethylbutyl)imino-2,5-cyclohexadien-1-ylidene- is a chemical compound with the molecular formula C18H22N2. It is also known as a Schiff base derivative of cyclohexadiene. Benzenamine, N-4-(1,3-dimethylbutyl)imino-2,5-cyclohexadien-1-ylidene- has potential applications in organic synthesis, medicinal chemistry, and materials science. It can be used in the preparation of various organic compounds and as a building block in the synthesis of complex molecules. Additionally, it has been studied for its potential biological activities and pharmacological properties. The unique structure and reactivity of this compound make it a valuable tool in chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 52870-46-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,8,7 and 0 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 52870-46:
(7*5)+(6*2)+(5*8)+(4*7)+(3*0)+(2*4)+(1*6)=129
129 % 10 = 9
So 52870-46-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H22N2/c1-14(2)13-15(3)19-17-9-11-18(12-10-17)20-16-7-5-4-6-8-16/h4-12,14-15H,13H2,1-3H3/b19-17-,20-18+