52943-22-3 Usage
Description
2-Chloro-N-ethyl-nicotinamide is an organic compound characterized by the presence of a chloro and ethyl group attached to a nicotinamide molecule. It is recognized for its unique structure and reactivity, which makes it a valuable building block in the synthesis of pharmaceuticals and other organic compounds. The chloro group in this compound is capable of engaging in reactions to form new chemical bonds, while the nicotinamide part is known for its biological activity, contributing to the therapeutic potential of the resulting compounds.
Uses
Used in Pharmaceutical Synthesis:
2-Chloro-N-ethyl-nicotinamide serves as a key intermediate in the development of pharmaceuticals. Its chloro group allows for the formation of new chemical bonds, which is crucial in creating a variety of drug molecules. The nicotinamide component, being biologically active, can be integrated into therapeutic agents, enhancing their efficacy and contributing to their medicinal properties.
Used in Organic Chemistry:
In the field of organic chemistry, 2-Chloro-N-ethyl-nicotinamide is utilized as a versatile building block for synthesizing a range of organic compounds. Its reactivity and structural features make it suitable for various chemical reactions, facilitating the creation of complex organic molecules with specific functions and applications.
Safety Considerations:
Given the potential hazards associated with 2-Chloro-N-ethyl-nicotinamide, it is imperative to handle and use this chemical in accordance with proper safety guidelines. This ensures the protection of individuals involved in its synthesis and application, as well as the environment, from any adverse effects that may arise from improper handling or exposure.
Check Digit Verification of cas no
The CAS Registry Mumber 52943-22-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,9,4 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 52943-22:
(7*5)+(6*2)+(5*9)+(4*4)+(3*3)+(2*2)+(1*2)=123
123 % 10 = 3
So 52943-22-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9ClN2O/c1-2-10-8(12)6-4-3-5-11-7(6)9/h3-5H,2H2,1H3,(H,10,12)
