52998-13-7 Usage
General Description
4-Pyridyl Thioacetyl Chloride, also known as 2-chloroacetyl-1-methylpyridine, is a chemical compound that belongs to the group of thioesters. It's primarily used in organic synthesis processes, specifically in facilitating various condensation reactions. The compound contains acetyl chloride and pyridine groups, with a molecular formula of C7H6ClNOS. Its inherent toxicity, volatility, and reactive nature mandate additional precautions during handling and storage. However, it's noteworthy for its significant role in chemical research and pharmaceutical manufacturing.
Check Digit Verification of cas no
The CAS Registry Mumber 52998-13-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,9,9 and 8 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 52998-13:
(7*5)+(6*2)+(5*9)+(4*9)+(3*8)+(2*1)+(1*3)=157
157 % 10 = 7
So 52998-13-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H6ClNOS/c8-7(10)5-11-6-1-3-9-4-2-6/h1-4H,5H2
