53221-07-1 Usage
Description
2-(dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol is an organic compound with the molecular formula C28H34Cl2NO. It is an impurity formed during the synthesis of Lumefantrine (L474000), which is a fluorene (F462000) derivative and belongs to the aryl amino alcohol class of anti-malarial drugs. 2-(dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol is characterized by its dibutylamino and dichloro-fluorenyl functional groups, which contribute to its chemical properties and potential applications.
Uses
Used in Pharmaceutical Industry:
2-(dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol is used as an impurity in the synthesis of Lumefantrine, an anti-malarial drug. Its presence during the synthesis process is crucial for the development of Lumefantrine, which is effective in treating malaria caused by Plasmodium falciparum.
2-(dibutylamino)-1-(2,7-dichloro-9H-fluoren-4-yl)ethanol plays a role in the chemical reactions involved in the production of Lumefantrine, contributing to the overall efficacy of the final drug product. By understanding the properties and behavior of this impurity, researchers and pharmaceutical manufacturers can optimize the synthesis process and ensure the quality and safety of the anti-malarial drug.
Check Digit Verification of cas no
The CAS Registry Mumber 53221-07-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,2,2 and 1 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 53221-07:
(7*5)+(6*3)+(5*2)+(4*2)+(3*1)+(2*0)+(1*7)=81
81 % 10 = 1
So 53221-07-1 is a valid CAS Registry Number.
InChI:InChI=1/C23H29Cl2NO/c1-3-5-9-26(10-6-4-2)15-22(27)21-14-19(25)13-17-11-16-12-18(24)7-8-20(16)23(17)21/h7-8,12-14,22,27H,3-6,9-11,15H2,1-2H3