535-32-0 Usage
Description
D-ETHIONINE is an amino acid derivative, specifically an S-ethylhomocysteine with R-configuration at the chiral center. It is a white crystalline solid known for its unique chemical properties and potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
D-ETHIONINE is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure allows it to interact with various biological systems, making it a promising candidate for the development of new drugs and therapies.
Used in Chemical Synthesis:
As an amino acid derivative, D-ETHIONINE is used as a building block in the synthesis of various organic compounds. Its R-configuration at the chiral center provides a distinct advantage in the development of enantiomerically pure compounds, which are essential in the pharmaceutical, agrochemical, and fragrance industries.
Used in Research and Development:
D-ETHIONINE serves as an important research tool in the field of biochemistry and molecular biology. Its unique properties make it useful for studying protein structure, function, and interactions, as well as for investigating the mechanisms of various biological processes.
Used in Nutritional Supplements:
Due to its amino acid derivative nature, D-ETHIONINE may be used as an ingredient in nutritional supplements, potentially offering benefits for muscle growth, recovery, and overall health. However, further research is needed to fully understand its effects and establish appropriate dosages for supplementation.
Check Digit Verification of cas no
The CAS Registry Mumber 535-32-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,3 and 5 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 535-32:
(5*5)+(4*3)+(3*5)+(2*3)+(1*2)=60
60 % 10 = 0
So 535-32-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1