537-09-7 Usage
Description
Evernic acid is a secondary metabolite derived from certain species of lichen, known for its ability to bind to allosteric sites on the protein surface of FAS-II enzymes. This interaction results in significant antibacterial and antiplasmodial effects, making it a promising compound for various pharmaceutical applications.
Uses
Used in Pharmaceutical Industry:
Evernic acid is used as an antibacterial agent for its ability to inhibit the growth of various bacteria by binding to FAS-II enzymes, thus disrupting their normal functioning.
Used in Antimalarial Applications:
Evernic acid is used as an antiplasmodial agent for its effectiveness against plasmodial FAS-II enzymes PfFabZ and PfFabI, which play a crucial role in the growth and survival of malaria parasites. Although it shows low efficacy against the malaria parasite P. berghei, its potential to inhibit key plasmodial enzymes makes it a valuable compound for further research and development in the fight against malaria.
Check Digit Verification of cas no
The CAS Registry Mumber 537-09-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,3 and 7 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 537-09:
(5*5)+(4*3)+(3*7)+(2*0)+(1*9)=67
67 % 10 = 7
So 537-09-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H10O4/c1-5-3-6(13-2)4-7(10)8(5)9(11)12/h3-4,10H,1-2H3,(H,11,12)
