537-12-2 Usage
Description
Diperodon Hydrochloride is a chemical compound with antiviral properties, specifically acting as an inhibitor of Ebola virus (EBOV) and Marburg virus (MARV). It functions through the antagonist activity of the G protein-coupled receptor (GPCR), making it a valuable compound in the field of virology and pharmaceutical research.
Uses
Used in Pharmaceutical Industry:
Diperodon Hydrochloride is used as an antiviral agent for its ability to inhibit the replication and spread of Ebola virus (EBOV) and Marburg virus (MARV). Its mechanism of action involves the antagonism of the G protein-coupled receptor (GPCR), which plays a crucial role in the viral life cycle and pathogenesis. This application is particularly relevant in the development of treatments and therapies for viral hemorrhagic fevers caused by EBOV and MARV.
Check Digit Verification of cas no
The CAS Registry Mumber 537-12-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,3 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 537-12:
(5*5)+(4*3)+(3*7)+(2*1)+(1*2)=62
62 % 10 = 2
So 537-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H27N3O4.ClH/c26-21(23-18-10-4-1-5-11-18)28-17-20(16-25-14-8-3-9-15-25)29-22(27)24-19-12-6-2-7-13-19;/h1-2,4-7,10-13,20H,3,8-9,14-17H2,(H,23,26)(H,24,27);1H