53917-42-3 Usage
Description
CLIP (Cross-Linked Interferon-Gamma Inducible Protein) is a protein that plays a crucial role in the immune system. It is involved in various cellular processes, including signal transduction, protein transport, and immune response regulation. CLIP is synthesized from its precursor pro-opiomelanocortin (POMC) and is released from the anterior pituitary gland in response to corticotropin-releasing hormone (CRH) from the hypothalamus. The gene encoding CLIP is localized on human chromosome 2p23.3.
Uses
Used in Mass Spectrometry Applications:
CLIP is used as a peptide calibration standard for matrix-assisted laser desorption/ionization (MALDI) time-of-flight (TOF) mass spectrometry (MS) and MALDI-MS instruments. It helps in the accurate measurement and identification of peptides and proteins in various research and diagnostic applications.
Used in Immune Response Regulation:
CLIP plays a significant role in the immune system, particularly in the regulation of signal transduction and protein transport. It is involved in the immune response against various pathogens and contributes to the overall defense mechanism of the body.
Used in Research and Diagnostics:
CLIP is used in research and diagnostic applications to study the molecular mechanisms underlying immune response and cellular processes. It serves as a valuable tool for understanding the role of CLIP in various diseases and conditions, as well as for the development of new therapeutic strategies.
Biochem/physiol Actions
Facilitatory effect exerted on paradoxical sleep in the rat: stimulates insulin release.
Check Digit Verification of cas no
The CAS Registry Mumber 53917-42-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,9,1 and 7 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 53917-42:
(7*5)+(6*3)+(5*9)+(4*1)+(3*7)+(2*4)+(1*2)=133
133 % 10 = 3
So 53917-42-3 is a valid CAS Registry Number.
InChI:InChI=1/C112H165N27O36/c1-56(2)48-72(100(163)125-70(37-41-86(148)149)97(160)133-77(111(174)175)51-63-24-14-11-15-25-63)129-103(166)79-28-20-46-138(79)109(172)75(49-62-22-12-10-13-23-62)131-93(156)61(9)121-95(158)68(35-39-84(144)145)123-92(155)60(8)122-102(165)78(55-140)134-98(161)71(38-42-87(150)151)126-101(164)74(53-88(152)153)128-96(159)69(36-40-85(146)147)124-91(154)59(7)120-83(143)54-119-94(157)73(52-82(115)142)130-104(167)80-29-21-47-139(80)110(173)76(50-64-31-33-65(141)34-32-64)132-107(170)89(57(3)4)135-99(162)67(27-16-17-43-113)127-106(169)90(58(5)6)136-105(168)81-30-19-45-137(81)108(171)66(114)26-18-44-118-112(116)117/h10-15,22-25,31-34,56-61,66-81,89-90,140-141H,16-21,26-30,35-55,113-114H2,1-9H3,(H2,115,142)(H,119,157)(H,120,143)(H,121,158)(H,122,165)(H,123,155)(H,124,154)(H,125,163)(H,126,164)(H,127,169)(H,128,159)(H,129,166)(H,130,167)(H,131,156)(H,132,170)(H,133,160)(H,134,161)(H,135,162)(H,136,168)(H,144,145)(H,146,147)(H,148,149)(H,150,151)(H,152,153)(H,174,175)(H4,116,117,118)