5407-70-5 Usage
Chemical structure
A compound synthesized from 5-nitro-2-furaldehyde and semicarbazide.
Application
Used as an analytical reagent for the determination of metal ions in various samples.
Pharmacological properties
Exhibits potential to inhibit the growth of certain bacteria and fungi.
Anti-inflammatory activity
Investigated for its potential to reduce inflammation.
Antioxidant activity
Explored for its potential to neutralize harmful free radicals and protect cells.
Chemotherapeutic potential
Being explored for its antitumor and cytotoxic properties, which could be useful in cancer treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 5407-70-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,0 and 7 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5407-70:
(6*5)+(5*4)+(4*0)+(3*7)+(2*7)+(1*0)=85
85 % 10 = 5
So 5407-70-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4O4/c1-4(9-10-7(8)12)5-2-3-6(15-5)11(13)14/h2-3H,1H3,(H3,8,10,12)/b9-4-
