5413-80-9 Usage
General Description
1H-Pyrazolo[3,4-d]pyrimidine-4,6-diamine, also recognized under the index name 9CI, is a chemical compound. As an organic compound, it's also categorized as a heteroaromatic compound comprising a pyrazolo[3,4-d]pyrimidine core, a type of fused pyridazine that carries two amine groups at positions 4 and 6. This chemical could potentially have different applications in research and industrial settings, however, more information would be required to define its exact use or role in a specific context such as its properties, possible reactions, and safety considerations.
Check Digit Verification of cas no
The CAS Registry Mumber 5413-80-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,1 and 3 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5413-80:
(6*5)+(5*4)+(4*1)+(3*3)+(2*8)+(1*0)=79
79 % 10 = 9
So 5413-80-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N6/c6-3-2-1-8-11-4(2)10-5(7)9-3/h1H,(H5,6,7,8,9,10,11)