5427-28-1 Usage
Description
(2,5-dioxoimidazolidin-4-ylidene)acetic acid, also known as DIAA, is a heterocyclic organic compound with the molecular formula C5H6N2O4. It belongs to the class of imidazolidines, which are characterized by a five-membered ring with three carbon atoms and two nitrogen atoms. DIAA is a versatile compound with potential applications in various fields, including pharmaceuticals, agriculture, and materials science.
Uses
Used in Pharmaceutical Industry:
(2,5-dioxoimidazolidin-4-ylidene)acetic acid is used as a building block for the synthesis of new molecules with biological activity. Its unique structure allows for the development of compounds with potential therapeutic effects.
Used in Agriculture:
(2,5-dioxoimidazolidin-4-ylidene)acetic acid is used as a potential antimicrobial agent. Its ability to inhibit the growth of microorganisms makes it a promising candidate for the development of new antibiotics and disinfectants in agricultural applications.
Used in Materials Science:
(2,5-dioxoimidazolidin-4-ylidene)acetic acid is used as a precursor for the production of polymers and materials with specific properties. Its versatile chemical structure allows for the creation of materials with tailored characteristics for various applications.
Overall, (2,5-dioxoimidazolidin-4-ylidene)acetic acid is a valuable chemical with diverse potential applications, and its continued research and development can lead to innovative solutions in multiple industries.
Check Digit Verification of cas no
The CAS Registry Mumber 5427-28-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 7 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 5427-28:
(6*5)+(5*4)+(4*2)+(3*7)+(2*2)+(1*8)=91
91 % 10 = 1
So 5427-28-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N2O4/c8-3(9)1-2-4(10)7-5(11)6-2/h1H,(H,8,9)(H2,6,7,10,11)/b2-1+
5427-28-1Relevant articles and documents
Process for preparing orotic acid
-
, (2008/06/13)
A method for the preparation of orotic acid and thioorotic acid is described which includes the formation of carboxymethylene-hydantoin or -thiohydantoin and subsequent rearrangement and isolation of orotic acid and thioorotic acid, respectively.
