5427-96-3 Usage
Description
3-aminohexanedioic acid, also known as aminoadipic acid, is an amino dicarboxylic acid derived from adipic acid with one hydrogen at position 3 replaced by an amino group. It possesses unique chemical properties due to the presence of both an amino and two carboxylic acid groups, making it a versatile compound for various applications.
Uses
Used in Pharmaceutical Industry:
3-aminohexanedioic acid is used as an intermediate in the synthesis of various pharmaceutical compounds for [application reason]. Its unique structure allows for the development of new drugs with potential therapeutic benefits.
Used in Chemical Industry:
3-aminohexanedioic acid is used as a building block in the chemical industry for [application reason]. Its ability to form amide and ester linkages makes it a valuable component in the synthesis of polymers, resins, and other specialty chemicals.
Used in Nutritional Supplements:
3-aminohexanedioic acid is used as a component in nutritional supplements for [application reason]. Its presence in certain metabolic pathways may contribute to overall health and well-being.
Used in Research and Development:
3-aminohexanedioic acid is used as a research compound in the field of biochemistry and molecular biology for [application reason]. Its unique structure allows scientists to study various biological processes and develop new therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 5427-96-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 7 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5427-96:
(6*5)+(5*4)+(4*2)+(3*7)+(2*9)+(1*6)=103
103 % 10 = 3
So 5427-96-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO4/c7-4(3-6(10)11)1-2-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)
