54333-94-7 Usage
Description
(6R-cis)-3-(hydroxymethyl)-7-methoxy-8-oxo-7-(2-thienylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid is a complex organic compound with a unique molecular structure. It is characterized by its bicyclic ring system, which includes a thiazole and an azabicycle, as well as various functional groups such as hydroxymethyl, methoxy, and thienylacetamido moieties. (6R-cis)-3-(hydroxymethyl)-7-methoxy-8-oxo-7-(2-thienylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid is likely to have specific interactions with biological systems due to its structural features and functional groups.
Uses
Used in Pharmaceutical Industry:
(6R-cis)-3-(hydroxymethyl)-7-methoxy-8-oxo-7-(2-thienylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid is used as a pharmaceutical compound for its potential therapeutic applications. (6R-cis)-3-(hydroxymethyl)-7-methoxy-8-oxo-7-(2-thienylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid's unique structure and functional groups may allow it to interact with specific biological targets, making it a candidate for the development of new drugs.
Used in Antibacterial Applications:
As an impurity of Cefoxitin, a semi-synthetic antibiotic, (6R-cis)-3-(hydroxymethyl)-7-methoxy-8-oxo-7-(2-thienylacetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid may contribute to the overall antibacterial properties of the drug. Cefoxitin is known for its high resistance to β-lactamase inactivation, which makes it effective against a range of bacterial infections.
Check Digit Verification of cas no
The CAS Registry Mumber 54333-94-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,3,3 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 54333-94:
(7*5)+(6*4)+(5*3)+(4*3)+(3*3)+(2*9)+(1*4)=117
117 % 10 = 7
So 54333-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2O6S2/c1-23-15(16-10(19)5-9-3-2-4-24-9)13(22)17-11(12(20)21)8(6-18)7-25-14(15)17/h2-4,14,18H,5-7H2,1H3,(H,16,19)(H,20,21)/t14-,15-/m1/s1