5436-79-3 Usage
Molecular weight
160.21 g/mol
The relative molecular mass of the compound is 160.21 grams per mole.
Appearance
Colorless to pale yellow liquid
The compound is typically a colorless or pale yellow liquid in its pure form.
Boiling point
214-216°C (419-430°F)
The compound boils at a temperature range of 214-216°C (419-430°F).
Melting point
-69°C (-92°F)
The compound freezes at a temperature of -69°C (-92°F).
Solubility
Mixable with most organic solvents
The compound is soluble in most organic solvents, such as ethanol, acetone, and ether.
Odor
Fruity, pineapple-like
The compound has a distinct fruity, pineapple-like odor.
8. Usage as a flavoring agent and fragrance ingredient
The compound is used in the food and cosmetics industry to impart a sweet, fruity aroma to various products, such as perfumes, lotions, and other personal care items.
9. Usage as a solvent
The compound serves as a solvent in the production of lacquers, paints, and coatings, making it a versatile compound with various industrial applications.
Chemical structure
t-Butyl propionate group attached to a methoxypropan-2-yl group
The compound's structure consists of a t-butyl propionate group connected to a methoxypropan-2-yl group, contributing to its diverse properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 5436-79-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 6 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5436-79:
(6*5)+(5*4)+(4*3)+(3*6)+(2*7)+(1*9)=103
103 % 10 = 3
So 5436-79-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H16O3/c1-6(2)8(9)11-7(3)5-10-4/h6-7H,5H2,1-4H3
