54363-90-5 Usage
Description
17-(4-Hydroxy-3-methylphenyl)-2,4,6,8,10,12,14,16-heptadecaoctenoic acid [2-dodecyl-3-hydroxy-5-methylphenyl] ester, also known as a flexirubin derivative, is a complex organic compound formed by the condensation of the carboxy group of a specific heptadecaoctenoic acid with one of the phenolic hydroxy groups of 2-dodecyl-5-methyl resorcinol. This molecule is characterized by its unique structure and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
17-(4-Hydroxy-3-methylphenyl)-2,4,6,8,10,12,14,16-heptadecaoctenoic acid [2-dodecyl-3-hydroxy-5-methylphenyl] ester is used as a pharmaceutical compound for its potential therapeutic properties. The complex structure of this molecule allows it to interact with various biological targets, making it a promising candidate for the development of new drugs.
Used in Cosmetic Industry:
In the cosmetic industry, 17-(4-Hydroxy-3-methylphenyl)-2,4,6,8,10,12,14,16-heptadecaoctenoic acid [2-dodecyl-3-hydroxy-5-methylphenyl] ester is used as an active ingredient for its potential benefits to skin health. 17-(4-Hydroxy-3-methylphenyl)-2,4,6,8,10,12,14,16-heptadecaoctenoic acid [2-dodecyl-3-hydroxy-5-methylphenyl] ester's unique structure may contribute to improved skin hydration, elasticity, and overall appearance.
Used in Research and Development:
This flexirubin derivative is also used in research and development for its potential applications in various scientific fields. 17-(4-Hydroxy-3-methylphenyl)-2,4,6,8,10,12,14,16-heptadecaoctenoic acid [2-dodecyl-3-hydroxy-5-methylphenyl] ester's unique properties make it an interesting subject for further study, which could lead to the discovery of new uses and applications in areas such as medicine, biotechnology, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 54363-90-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,3,6 and 3 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 54363-90:
(7*5)+(6*4)+(5*3)+(4*6)+(3*3)+(2*9)+(1*0)=125
125 % 10 = 5
So 54363-90-5 is a valid CAS Registry Number.
InChI:InChI=1/C43H54O4/c1-4-5-6-7-8-9-17-20-23-26-29-39-41(45)33-36(2)34-42(39)47-43(46)30-27-24-21-18-15-13-11-10-12-14-16-19-22-25-28-38-31-32-40(44)37(3)35-38/h10-16,18-19,21-22,24-25,27-28,30-35,44-45H,4-9,17,20,23,26,29H2,1-3H3/b12-10+,13-11+,16-14+,18-15+,22-19+,24-21+,28-25+,30-27+