5437-51-4 Usage
General Description
2-amino-N,N-diethyl-4-oxo-5,6,7,8-tetrahydro-1H-quinazoline-6-carboxamide is a chemical compound with a complex molecular structure. It belongs to the class of quinazoline derivatives and contains an amino group, two ethyl groups, and a carboxamide group. 2-amino-N,N-diethyl-4-oxo-5,6,7,8-tetrahydro-1H-quinazoline-6-carboxam ide has potential therapeutic applications due to its structural similarity to quinazoline-based pharmaceuticals, which are known for their diverse biological activities such as anti-cancer, anti-inflammatory, and anti-microbial properties. Research is ongoing to explore the pharmacological effects and potential medicinal uses of 2-amino-N,N-diethyl-4-oxo-5,6,7,8-tetrahydro-1H-quinazoline-6-carboxamide. Additionally, it can also serve as a valuable intermediate in the synthesis of various organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 5437-51-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 7 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5437-51:
(6*5)+(5*4)+(4*3)+(3*7)+(2*5)+(1*1)=94
94 % 10 = 4
So 5437-51-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H20N4O2/c1-3-17(4-2)12(19)8-5-6-10-9(7-8)11(18)16-13(14)15-10/h8H,3-7H2,1-2H3,(H3,14,15,16,18)
