5439-97-4 Usage
General Description
[(4-methylcyclohexylidene)amino]urea is a chemical compound that is commonly used as an antiviral agent and a potential treatment for various viral infections. It has been found to inhibit the replication of certain viruses, including influenza and herpes simplex virus. The compound works by targeting the viral machinery and interfering with the virus's ability to replicate and spread. It is also being studied for its potential use in treating other conditions, such as cancer, due to its ability to inhibit the growth and spread of cancer cells. Additionally, [(4-methylcyclohexylidene)amino]urea may have potential applications in the field of pharmaceuticals and drug development due to its unique chemical structure and biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 5439-97-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 9 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5439-97:
(6*5)+(5*4)+(4*3)+(3*9)+(2*9)+(1*7)=114
114 % 10 = 4
So 5439-97-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H15N3O/c1-6-2-4-7(5-3-6)10-11-8(9)12/h6H,2-5H2,1H3,(H3,9,11,12)/b10-7-
