5441-26-9 Usage
Main properties
1. Molecular formula: C16H16O4
2. Contains two methoxy groups and a phenylmethyl group
3. Commonly used as a building block in organic synthesis and pharmaceutical research
4. Studied for potential therapeutic properties in anti-inflammatory and analgesic medications
5. Investigated for potential use as a corrosion inhibitor in industrial applications
Specific content
Derivative of benzoic acid
Contains two methoxy groups and a phenylmethyl group
Used in organic synthesis and pharmaceutical research
Studied for potential therapeutic properties in anti-inflammatory and analgesic medications
Investigated for potential use as a corrosion inhibitor in industrial applications
Further research needed to fully understand properties and potential applications
Check Digit Verification of cas no
The CAS Registry Mumber 5441-26-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,4 and 1 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5441-26:
(6*5)+(5*4)+(4*4)+(3*1)+(2*2)+(1*6)=79
79 % 10 = 9
So 5441-26-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H16O4/c1-19-14-10-6-5-9-13(14)15(20-2)11-7-3-4-8-12(11)16(17)18/h3-10,15H,1-2H3,(H,17,18)
