544455-87-0 Usage
Description
3-AMINO-4-(NAPHTHALEN-2-YL)BUTANOIC ACID is a chemical compound with the molecular formula C16H17NO2 and CAS number 90130-57-5. It is a derivative of naphthalene, featuring a naphthalene ring with an attached butanoic acid moiety. 3-AMINO-4-(NAPHTHALEN-2-YL)BUTANOIC ACID is recognized for its potential to exhibit various biological activities and is commonly utilized as a building block in the synthesis of pharmaceuticals and agrochemicals. Its presence of a primary amine group also allows it to be used as a ligand in metal coordination chemistry. This makes 3-AMINO-4-(NAPHTHALEN-2-YL)BUTANOIC ACID a valuable tool in medicinal chemistry research and a versatile component across the fields of medicine, agriculture, and chemistry.
Uses
Used in Pharmaceutical Industry:
3-AMINO-4-(NAPHTHALEN-2-YL)BUTANOIC ACID is used as a building block for the synthesis of various pharmaceuticals due to its potential to exhibit multiple biological activities. Its incorporation into drug molecules can lead to the development of new therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical field, 3-AMINO-4-(NAPHTHALEN-2-YL)BUTANOIC ACID is used as a component in the development of agrochemicals, contributing to the creation of effective products for agricultural applications.
Used in Medicinal Chemistry Research:
3-AMINO-4-(NAPHTHALEN-2-YL)BUTANOIC ACID serves as a valuable tool in medicinal chemistry research, where it aids in the exploration of new chemical entities and the enhancement of existing pharmaceutical compounds.
Used in Metal Coordination Chemistry:
3-AMINO-4-(NAPHTHALEN-2-YL)BUTANOIC ACID is used as a ligand in metal coordination chemistry, capitalizing on its primary amine group to form complexes with metal ions for various applications in the chemical and related industries.
Check Digit Verification of cas no
The CAS Registry Mumber 544455-87-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,4,4,4,5 and 5 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 544455-87:
(8*5)+(7*4)+(6*4)+(5*4)+(4*5)+(3*5)+(2*8)+(1*7)=170
170 % 10 = 0
So 544455-87-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H15NO2/c15-13(9-14(16)17)8-10-5-6-11-3-1-2-4-12(11)7-10/h1-7,13H,8-9,15H2,(H,16,17)
