5447-21-2 Usage
General Description
Thiobis(acetohydrazide) is a chemical compound with the molecular formula C4H10N4S. It is also known as bis(1-hydrazinocarbonylthio)ethane and is used as a corrosion inhibitor and in the synthesis of pharmaceuticals. Thiobis(acetohydrazide) has the potential to act as a chelating agent, and it is also used as a reducing agent in organic synthesis. Its ability to chelate with metal ions makes it a valuable compound in the field of coordination chemistry. Additionally, it has been investigated for its potential antimicrobial and anti-cancer properties. Overall, Thiobis(acetohydrazide) has a diverse range of applications in various fields, making it a versatile and valuable chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 5447-21-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,4 and 7 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5447-21:
(6*5)+(5*4)+(4*4)+(3*7)+(2*2)+(1*1)=92
92 % 10 = 2
So 5447-21-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H10N4O2S/c5-7-3(9)1-11-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10)