5454-67-1 Usage
Description
[(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea is a urea derivative chemical compound characterized by its unique molecular structure, which includes an imidazolidin-4-yl ring and a methylideneamino group. It is recognized for its potential as a versatile building block in the synthesis of biologically active molecules and has garnered interest for its possible applications in various industries, particularly in pharmaceuticals.
Uses
Used in Pharmaceutical Applications:
[(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea is used as a building block for the synthesis of biologically active molecules due to its unique molecular structure. Its potential in creating new pharmaceutical compounds makes it a valuable asset in drug development.
Used in Anti-Cancer Research:
[(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea is used as a potential anti-cancer agent. It has been studied for its ability to inhibit the activity of specific enzymes involved in various cellular processes, which could contribute to the development of novel cancer treatments.
Used in Enzyme Inhibition Studies:
[(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea is used as a compound for studying its potential to inhibit the activity of specific enzymes. This application can lead to a better understanding of enzyme functions and the development of targeted therapies for various diseases.
Used in Industrial Applications:
[(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea is used as a versatile building block in various industrial applications, taking advantage of its unique molecular structure to create a wide range of products with different properties and functions.
Further research is being conducted to explore the potential uses and applications of [(4-ethyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea in different fields, as its unique properties and potential make it a promising compound for future developments.
Check Digit Verification of cas no
The CAS Registry Mumber 5454-67-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,5 and 4 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5454-67:
(6*5)+(5*4)+(4*5)+(3*4)+(2*6)+(1*7)=101
101 % 10 = 1
So 5454-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N5O3/c1-2-7(3-9-12-5(8)14)4(13)10-6(15)11-7/h3H,2H2,1H3,(H3,8,12,14)(H2,10,11,13,15)/b9-3+