5454-69-3 Usage
Description
[(2,5-dioxo-4-pentyl-imidazolidin-4-yl)methylideneamino]thiourea is a complex chemical compound derived from thiourea, featuring a pentyl substituent on the imidazolidine ring. This white solid is sparingly soluble in water and organic solvents, and its chemical structure, which includes a thiourea functional group, suggests potential applications in various chemical reactions and processes. Its structural complexity may also indicate possible uses in pharmaceuticals, agrochemicals, or materials science, although further research and testing are required to fully comprehend its properties and potential applications.
Uses
Used in Pharmaceutical Industry:
[(2,5-dioxo-4-pentyl-imidazolidin-4-yl)methylideneamino]thiourea is used as a potential active pharmaceutical ingredient for [application reason, e.g., targeting specific biological pathways or diseases]. Its unique structure and thiourea functional group may allow for the development of novel drugs with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical industry, [(2,5-dioxo-4-pentyl-imidazolidin-4-yl)methylideneamino]thiourea is used as a potential component in the development of new pesticides or herbicides for [application reason, e.g., targeting specific pests or weeds with minimal environmental impact].
Used in Materials Science:
[(2,5-dioxo-4-pentyl-imidazolidin-4-yl)methylideneamino]thiourea is used as a building block or additive in the synthesis of new materials for [application reason, e.g., enhancing the properties of polymers or creating new composites with specific characteristics].
Check Digit Verification of cas no
The CAS Registry Mumber 5454-69-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,5 and 4 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5454-69:
(6*5)+(5*4)+(4*5)+(3*4)+(2*6)+(1*9)=103
103 % 10 = 3
So 5454-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H17N5O2S/c1-2-3-4-5-10(6-12-15-8(11)18)7(16)13-9(17)14-10/h6H,2-5H2,1H3,(H3,11,15,18)(H2,13,14,16,17)/b12-6+
