5455-07-2 Usage
Chemical group
Nitroaromatic derivatives
A class of chemical compounds containing a carbon-nitrogen double bond (C=N) and a nitro group (-NO2) attached to an aromatic ring.
Fluorene backbone
A polycyclic aromatic hydrocarbon consisting of a three-ring structure, which provides the basic structure for the compound.
Dinitro functional group
Two nitro groups (-NO2) attached to the aromatic ring, which contribute to the compound's yellowish color and stability.
Methoxyphenylimino functional group
A phenyl ring with a methoxy group (-OCH3) and an imino group (=N-) attached, which influences the compound's chemical reactivity and properties.
Yellowish solid
The physical appearance of the compound, indicating its stability and resistance to oxidation.
Relative stability
The compound's resistance to chemical reactions and decomposition, making it suitable for various applications.
Resistance to oxidation
The compound's ability to withstand reactions with oxygen, which can lead to degradation or alteration of its properties.
Organic synthesis
The compound's use in chemical reactions to form new compounds, often as an intermediate step in the synthesis of more complex molecules.
Intermediate in production of dyes, pigments, and pharmaceuticals
The compound's role as a precursor or building block in the synthesis of various commercial products, such as dyes, pigments, and pharmaceuticals.
Potential mutagenic and carcinogenic effects
The compound's ability to cause changes in genetic material or induce cancer, which necessitates careful handling and use to minimize health risks.
Check Digit Verification of cas no
The CAS Registry Mumber 5455-07-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,5 and 5 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5455-07:
(6*5)+(5*4)+(4*5)+(3*5)+(2*0)+(1*7)=92
92 % 10 = 2
So 5455-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H13N3O5/c1-28-14-8-5-12(6-9-14)21-20-16-3-2-4-18(23(26)27)19(16)15-10-7-13(22(24)25)11-17(15)20/h2-11H,1H3/b21-20-