5455-70-9 Usage
Description
1-(2-nitrophenyl)-2-pyridin-2-yl-ethanol is a chemical compound with the molecular formula C14H12N2O3, featuring a combination of nitrophenyl and pyridinyl groups attached to a central ethanol moiety. It is recognized for its potential biological activities, such as anti-inflammatory and antioxidant properties, and is being explored for its therapeutic potential in various diseases and conditions.
Uses
Used in Pharmaceutical Research:
1-(2-nitrophenyl)-2-pyridin-2-yl-ethanol is used as a research compound for its potential biological activities, including anti-inflammatory and antioxidant properties. It is being investigated for its possible applications in the treatment of various diseases and conditions.
Used in Cancer Treatment Research:
In the field of oncology, 1-(2-nitrophenyl)-2-pyridin-2-yl-ethanol is used as a potential therapeutic agent for cancer treatment. Its study is focused on understanding its effects on different types of cancer and how it may contribute to the development of novel cancer therapies.
Used in Neurodegenerative Disorder Research:
1-(2-nitrophenyl)-2-pyridin-2-yl-ethanol is also used as a research compound in the field of neurodegenerative disorders. Its potential as a treatment for conditions such as Alzheimer's, Parkinson's, and other related diseases is being explored due to its demonstrated biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 5455-70-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,5 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5455-70:
(6*5)+(5*4)+(4*5)+(3*5)+(2*7)+(1*0)=99
99 % 10 = 9
So 5455-70-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N2O3/c16-13(9-10-5-3-4-8-14-10)11-6-1-2-7-12(11)15(17)18/h1-8,13,16H,9H2
