5462-54-4 Usage
Description
[(4-hexyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea is a chemical compound with a molecular formula C13H24N4O3. It is an imidazolidin-4-one derivative and urea derivative, characterized by a hexyl chain and an imidazolidine-4-one skeleton. [(4-hexyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea is known for its potential biological activities and medicinal properties, making it a valuable asset in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
[(4-hexyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea is used as a compound with potential biological activities for its medicinal properties. It is recognized for its antibacterial, antiviral, and anti-inflammatory properties, as well as its ability to inhibit certain enzymes and biological processes, making it a promising candidate for the development of new drugs and therapies.
Used in Organic Synthesis:
In the field of organic synthesis, [(4-hexyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea is used as a building block or intermediate for the synthesis of more complex molecules. Its unique molecular structure and chemical properties allow it to be a versatile component in the creation of various organic compounds.
Used in Material Science:
[(4-hexyl-2,5-dioxo-imidazolidin-4-yl)methylideneamino]urea also finds applications in material science due to its distinctive molecular structure and chemical characteristics. It can be utilized in the development of new materials with specific properties, such as improved stability, reactivity, or biocompatibility, depending on the desired application.
Check Digit Verification of cas no
The CAS Registry Mumber 5462-54-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 2 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5462-54:
(6*5)+(5*4)+(4*6)+(3*2)+(2*5)+(1*4)=94
94 % 10 = 4
So 5462-54-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H19N5O3/c1-2-3-4-5-6-11(7-13-16-9(12)18)8(17)14-10(19)15-11/h7H,2-6H2,1H3,(H3,12,16,18)(H2,14,15,17,19)/b13-7+
