5463-96-7 Usage
Description
(1R,2R)-2-(6-chloropurin-9-yl)cyclohexan-1-ol is a complex chemical compound characterized by a cyclohexanol backbone and a 6-chloropurin-9-yl substituent. It is optically active, with stereocenters at the first and second carbon atoms on the cyclohexane ring. The purinyl group indicates potential biological activity, as purines are involved in various cellular processes. The chloro substituent enhances the compound's chemical reactivity and its potential for interactions with other molecules. This molecule holds promise for pharmaceutical or biological applications.
Uses
Used in Pharmaceutical Industry:
(1R,2R)-2-(6-chloropurin-9-yl)cyclohexan-1-ol is used as a potential pharmaceutical agent due to its unique structure and the presence of the purinyl group, which is known to be involved in various cellular processes. Its optical activity and the chloro substituent may contribute to its efficacy and selectivity in targeting specific biological pathways.
Used in Biological Research:
In the field of biological research, (1R,2R)-2-(6-chloropurin-9-yl)cyclohexan-1-ol serves as a valuable compound for studying the interactions between small molecules and biological systems. Its complex structure and potential reactivity make it an interesting subject for investigations into molecular recognition and binding mechanisms.
Used in Drug Development:
(1R,2R)-2-(6-chloropurin-9-yl)cyclohexan-1-ol is utilized in drug development as a lead compound for the design of new therapeutic agents. Its unique features, such as the cyclohexanol backbone and the 6-chloropurin-9-yl substituent, provide a foundation for the creation of novel molecules with improved pharmacological properties and targeted effects on specific diseases or conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 5463-96-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 3 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5463-96:
(6*5)+(5*4)+(4*6)+(3*3)+(2*9)+(1*6)=107
107 % 10 = 7
So 5463-96-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H13ClN4O/c12-10-9-11(14-5-13-10)16(6-15-9)7-3-1-2-4-8(7)17/h5-8,17H,1-4H2/t7-,8-/m1/s1
