54636-84-9 Usage
General Description
N-(4-Chloro-3-((4,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-1H-pyrazol-3-yl)amino)phenyl)myristamide is a synthetic compound with potential biomedical applications. It is a derivative of myristamide, a fatty acid that plays a role in various physiological processes. The chemical structure of N-(4-Chloro-3-((4,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-1H-pyrazol-3-yl)amino)phenyl)myristamide contains a phenylamino group and a pyrazol-3-yl group, both of which have been associated with potential therapeutic effects in different diseases. Its specific biological and pharmacological effects are still under investigation, but it holds promise as a potential drug candidate for the treatment of various conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 54636-84-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,6,3 and 6 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 54636-84:
(7*5)+(6*4)+(5*6)+(4*3)+(3*6)+(2*8)+(1*4)=139
139 % 10 = 9
So 54636-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C29H36Cl4N4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-27(38)34-21-14-15-22(31)25(18-21)35-26-19-28(39)37(36-26)29-23(32)16-20(30)17-24(29)33/h14-18H,2-13,19H2,1H3,(H,34,38)(H,35,36)